
Thermo Scientific Alfa Aesar Amberlite™ IRC-120(H), ion exchange resin, Thermo Scientific Chemicals
CAS: 78922-04-0 Formula molecolare: C13H10ClNO4S Molecular Weight (g/mol): 311.736 Numero MDL: MFCD00132707 InChI Key: APBOVLPLJFJSRI-UHFFFAOYSA-N Sinonimo: 3-3-chlorophenylsulfonamido benzoic acid,3-3-chloro-benzenesulfonylamino-benzoic acid,3-3-chlorophenyl sulfonyl amino benzoic acid,benzoicacid, 3-3-chlorophenyl sulfonyl amino,3-3-chlorobenzenesulfonamido benzoic acid,amberlite ir-120,3-3-chlorophenyl sulfonylamino benzoic acid,3-3-chlorophenyl sulfonamido benzoic acid PubChem CID: 8190984 IUPAC Name: 3-[(3-chlorophenyl)sulfonylamino]benzoic acid SMILES: C1=CC(=CC(=C1)NS(=O)(=O)C2=CC(=CC=C2)Cl)C(=O)O
Sinonimo | 3-3-chlorophenylsulfonamido benzoic acid,3-3-chloro-benzenesulfonylamino-benzoic acid,3-3-chlorophenyl sulfonyl amino benzoic acid,benzoicacid, 3-3-chlorophenyl sulfonyl amino,3-3-chlorobenzenesulfonamido benzoic acid,amberlite ir-120,3-3-chlorophenyl sulfonylamino benzoic acid,3-3-chlorophenyl sulfonamido benzoic acid |
---|---|
Numero MDL | MFCD00132707 |
PubChem CID | 8190984 |
Formula molecolare | C13H10ClNO4S |
CAS | 78922-04-0 |
Molecular Weight (g/mol) | 311.736 |
SMILES | C1=CC(=CC(=C1)NS(=O)(=O)C2=CC(=CC=C2)Cl)C(=O)O |
IUPAC Name | 3-[(3-chlorophenyl)sulfonylamino]benzoic acid |
InChI Key | APBOVLPLJFJSRI-UHFFFAOYSA-N |
Thermo Scientific Alfa Aesar Dowex™ 1X8 100-200 (Cl), Thermo Scientific Chemicals
CAS: 12627-85-9 Formula molecolare: C29H34ClN Molecular Weight (g/mol): 432.05 Numero MDL: MFCD00132718 InChI Key: BBQMUEOYPPPODD-UHFFFAOYSA-M Sinonimo: dowex 1x2 50-100 cl,dowex 1x8 50-100 cl PubChem CID: 16212807 IUPAC Name: 1,4-diethenylbenzene 4-ethenyl-N,N,N-trimethylanilinium ethenylbenzene chloride SMILES: *
Sinonimo | dowex 1x2 50-100 cl,dowex 1x8 50-100 cl |
---|---|
Numero MDL | MFCD00132718 |
PubChem CID | 16212807 |
Formula molecolare | C29H34ClN |
CAS | 12627-85-9 |
Molecular Weight (g/mol) | 432.05 |
SMILES | * |
IUPAC Name | 1,4-diethenylbenzene 4-ethenyl-N,N,N-trimethylanilinium ethenylbenzene chloride |
InChI Key | BBQMUEOYPPPODD-UHFFFAOYSA-M |
Thermo Scientific Alfa Aesar Amberlite XAD-16, Thermo Scientific Chemicals
CAS: 104219-63-8 Numero MDL: MFCD00145831
Numero MDL | MFCD00145831 |
---|---|
CAS | 104219-63-8 |
Thermo Scientific Alfa Aesar Amberlyst™ 15(H), ion exchange resin, Thermo Scientific Chemicals
CAS: 39389-20-3 Formula molecolare: C18H18O3S Molecular Weight (g/mol): 314.399 Numero MDL: MFCD00145841 InChI Key: SIWVGXQOXWGJCI-UHFFFAOYSA-N Sinonimo: amberlyst 15, wet, ion exchange resin,2-ethenylbenzenesulfonic acid; divinylbenzene,benzenesulfonic acid, ethenyl-, polymer with diethenylbenzene,ksc581g2r,amberlyst 15 ion-exchange resin,amberlite? ir120 hydrogen form,2-ethenylbenzenesulfonic acid-1,2-diethenylbenzene 1:1,amberlite r ir120 hydrogen form,divinylbenzene-styrenesulfonic acid copolymer,1,2-bis ethenyl benzene; 2-ethenylbenzenesulfonic acid PubChem CID: 170197 IUPAC Name: 1,2-bis(ethenyl)benzene;2-ethenylbenzenesulfonic acid SMILES: C=CC1=CC=CC=C1C=C.C=CC1=CC=CC=C1S(=O)(=O)O
Sinonimo | amberlyst 15, wet, ion exchange resin,2-ethenylbenzenesulfonic acid; divinylbenzene,benzenesulfonic acid, ethenyl-, polymer with diethenylbenzene,ksc581g2r,amberlyst 15 ion-exchange resin,amberlite? ir120 hydrogen form,2-ethenylbenzenesulfonic acid-1,2-diethenylbenzene 1:1,amberlite r ir120 hydrogen form,divinylbenzene-styrenesulfonic acid copolymer,1,2-bis ethenyl benzene; 2-ethenylbenzenesulfonic acid |
---|---|
Numero MDL | MFCD00145841 |
PubChem CID | 170197 |
Formula molecolare | C18H18O3S |
CAS | 39389-20-3 |
Molecular Weight (g/mol) | 314.399 |
SMILES | C=CC1=CC=CC=C1C=C.C=CC1=CC=CC=C1S(=O)(=O)O |
IUPAC Name | 1,2-bis(ethenyl)benzene;2-ethenylbenzenesulfonic acid |
InChI Key | SIWVGXQOXWGJCI-UHFFFAOYSA-N |
Thermo Scientific Alfa Aesar Amberlite XAD-7, Thermo Scientific Chemicals
CAS: 37380-43-1 Numero MDL: MFCD00132705
Numero MDL | MFCD00132705 |
---|---|
CAS | 37380-43-1 |
Thermo Scientific Acros Amberlite™ IRN-78 ion-exchange resin, OH-form, Thermo Scientific Chemicals
CAS: 11128-95-3 Numero MDL: MFCD00145822
Numero MDL | MFCD00145822 |
---|---|
CAS | 11128-95-3 |
Thermo Scientific Alfa Aesar Amberlite™ IRC-748, ion exchange resin, Thermo Scientific Chemicals
CAS: 79620-28-3 Numero MDL: MFCD00132702
Numero MDL | MFCD00132702 |
---|---|
CAS | 79620-28-3 |
Thermo Scientific Alfa Aesar Diaion™ HP20, synthetic adsorbent resin, highly porous type
Thermo Scientific Alfa Aesar AmberChrom™, 50WX8 200-400 (H), Thermo Scientific Chemicals
CAS: 11119-67-8 Numero MDL: MFCD00132726 IUPAC Name: AmberChrom™ 50WX8 Ion Exchange Resin
Numero MDL | MFCD00132726 |
---|---|
CAS | 11119-67-8 |
IUPAC Name | AmberChrom™ 50WX8 Ion Exchange Resin |
Thermo Scientific Alfa Aesar Amberlite IRA-410(Cl), ion exchange resin, Thermo Scientific Chemicals
CAS: 9002-26-0 Numero MDL: MFCD00132710
Numero MDL | MFCD00132710 |
---|---|
CAS | 9002-26-0 |
Thermo Scientific Acros AmberChrom™, 50WX8, 100-200 mesh, H-form, Thermo Scientific™
CAS: 69011-20-7 Formula molecolare: C28H30 Molecular Weight (g/mol): 0.00 Numero MDL: MFCD00132722 InChI Key: NWUYHJFMYQTDRP-UHFFFAOYSA-N IUPAC Name: 1,2-diethenylbenzene; 1-ethenyl-2-ethylbenzene; ethenylbenzene SMILES: *
Numero MDL | MFCD00132722 |
---|---|
Formula molecolare | C28H30 |
CAS | 69011-20-7 |
Molecular Weight (g/mol) | 0.00 |
SMILES | * |
IUPAC Name | 1,2-diethenylbenzene; 1-ethenyl-2-ethylbenzene; ethenylbenzene |
InChI Key | NWUYHJFMYQTDRP-UHFFFAOYSA-N |
Thermo Scientific Alfa Aesar Amberlite™ IRA-67, ion exchange resin, Thermo Scientific Chemicals
CAS: 80747-90-6 Numero MDL: MFCD00145567
Numero MDL | MFCD00145567 |
---|---|
CAS | 80747-90-6 |
Thermo Scientific Alfa Aesar AmberChrom 50Wx8 100-200 (H), Thermo Scientific Chemicals
CAS: 11119-67-8 Numero MDL: MFCD00132726 IUPAC Name: AmberChrom™ 50WX8 Ion Exchange Resin
Numero MDL | MFCD00132726 |
---|---|
CAS | 11119-67-8 |
IUPAC Name | AmberChrom™ 50WX8 Ion Exchange Resin |
Thermo Scientific Alfa Aesar Amberlite XAD-1180, Thermo Scientific Chemicals
CAS: 97396-56-0 Numero MDL: MFCD00145830
Numero MDL | MFCD00145830 |
---|---|
CAS | 97396-56-0 |