missing translation for 'onlineSavingsMsg'
Learn More
Learn More
3'-Nitropropiophenone, 97%, Thermo Scientific™
59.50€ - 733.00€
Identificatori chimici
| CAS | 17408-16-1 |
|---|---|
| Formula molecolare | C9H9NO3 |
| Molecular Weight (g/mol) | 179.175 |
| Numero MDL | MFCD00051516 |
| InChI Key | VSPOTMOYDHRALZ-UHFFFAOYSA-N |
| Sinonimo | 3'-nitropropiophenone, 1-3-nitrophenyl propan-1-one, m-nitropropiophenone, 3-nitrophenyl ethyl ketone, 1-propanone, 1-3-nitrophenyl, m-nitropropio-phenone, 3;-nitropropiophenone, acmc-209e7u, 3-nitropropiophenone, 1-3-nitrophenyl propan-l-one |
| PubChem CID | 87096 |
| IUPAC Name | 1-(3-nitrophenyl)propan-1-one |
| SMILES | CCC(=O)C1=CC(=CC=C1)[N+](=O)[O-] |
| Codice del prodotto | Marca | Quantità | Prezzo | Quantità e disponibilità | |||||
|---|---|---|---|---|---|---|---|---|---|
| Codice del prodotto | Marca | Quantità | Prezzo | Quantità e disponibilità | |||||
|
11461938
|
Thermo Scientific Alfa Aesar
A14554.06 |
5 g | N/A | ||||||
|
11471938
|
Thermo Scientific Alfa Aesar
A14554.14 |
25 g | N/A | ||||||
|
11481938
|
Thermo Scientific Alfa Aesar
A14554.22 |
100 g | N/A | ||||||
Descrizione
This Thermo Scientific brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
Identificatori chimici
| 17408-16-1 | |
| 179.175 | |
| VSPOTMOYDHRALZ-UHFFFAOYSA-N | |
| 87096 | |
| CCC(=O)C1=CC(=CC=C1)[N+](=O)[O-] |
| C9H9NO3 | |
| MFCD00051516 | |
| 3'-nitropropiophenone, 1-3-nitrophenyl propan-1-one, m-nitropropiophenone, 3-nitrophenyl ethyl ketone, 1-propanone, 1-3-nitrophenyl, m-nitropropio-phenone, 3;-nitropropiophenone, acmc-209e7u, 3-nitropropiophenone, 1-3-nitrophenyl propan-l-one | |
| 1-(3-nitrophenyl)propan-1-one |
Specifica
| 3'-Nitropropiophenone | |
| 99°C to 102°C | |
| MFCD00051516 | |
| 3'-nitropropiophenone, 1-3-nitrophenyl propan-1-one, m-nitropropiophenone, 3-nitrophenyl ethyl ketone, 1-propanone, 1-3-nitrophenyl, m-nitropropio-phenone, 3;-nitropropiophenone, acmc-209e7u, 3-nitropropiophenone, 1-3-nitrophenyl propan-l-one | |
| CCC(=O)C1=CC(=CC=C1)[N+](=O)[O-] | |
| 179.175 | |
| 179.18 |
| 17408-16-1 | |
| C9H9NO3 | |
| 1954069 | |
| VSPOTMOYDHRALZ-UHFFFAOYSA-N | |
| 1-(3-nitrophenyl)propan-1-one | |
| 87096 | |
| 97% |
Sicurezza e movimentazione
missing translation for 'einecsNumber' : 241-435-8
missing translation for 'tsca' : No
Recommended Storage : Ambient temperatures